CAS 1390654-53-1

4H-1,2,4-Triazole-3-methanamine, 4-(3-methoxypropyl)-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, 4-(3-methoxypropyl)-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a methanamine group and a propyl ether substituent, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is often advantageous for pharmaceutical applications. The presence of the methoxypropyl group may influence its lipophilicity and interaction with biological targets. Compounds of this nature are often investigated for their potential as pharmaceuticals, particularly in the fields of antifungal and antimicrobial research, due to the triazole moiety's known activity against various pathogens. Additionally, the specific arrangement of functional groups can affect the compound's pharmacokinetics and pharmacodynamics, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₇H₁₄N₄O·2ClH

InChI: InChI=1S/C7H14N4O.2ClH/c1-12-4-2-3-11-6-9-10-7(11)5-8;;/h6H,2-5,8H2,1H3;2*1H

InChI key: InChIKey=BIYSMMNPKXHEKT-UHFFFAOYSA-N

SMILES: C(CCOC)N1C(CN)=NN=C1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, 4-(3-methoxypropyl)-, hydrochloride (1:2)

{[4-(3-methoxypropyl)-4H-1,2,4-triazol-3-yl]methyl}amine dihydrochloride

CAS: 1390654-53-1

Formula: C₇H₁₆Cl₂N₄O

Purity: 95.0%

Molecular weight: 243.13

Ref: 10-F359312