CAS 1390654-70-2

1-Cyclohexene-1-methanamine, α-methyl-, hydrochloride (1:1)

Description:

1-Cyclohexene-1-methanamine, α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and cyclohexene structure. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The presence of the cyclohexene ring contributes to its unique reactivity, particularly in electrophilic addition reactions. The α-methyl group enhances steric hindrance, which can influence its interaction with other molecules and its overall reactivity. This compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its hydrochloride form is often used in pharmaceutical applications, where it may serve as an intermediate or active ingredient. Safety data should be consulted for handling and storage, as amines can be sensitive to moisture and air, potentially leading to degradation or unwanted reactions. Overall, this compound's structure and functional groups make it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₈H₁₅N·ClH

InChI: InChI=1S/C8H15N.ClH/c1-7(9)8-5-3-2-4-6-8;/h5,7H,2-4,6,9H2,1H3;1H

InChI key: InChIKey=QXYNNWUHVBNIKB-UHFFFAOYSA-N

SMILES: C(C)(N)C=1CCCCC1.Cl

Synonyms:

• 1-Cyclohexene-1-methanamine, α-methyl-, hydrochloride (1:1)

[1-(1-cyclohexen-1-yl)ethyl]amine hydrochloride

CAS: 1390654-70-2

Formula: C₈H₁₆ClN

Purity: 95.0%

Molecular weight: 161.67

Ref: 10-F359533