CAS 1390654-83-7

1H-Pyrazol-4-amine, 1-propyl-, hydrochloride (1:1)

Description:

1H-Pyrazol-4-amine, 1-propyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amine functional group at the 4-position of the pyrazole ring and a propyl group attached to the nitrogen atom, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride indicates that it can form a stable ionic compound, which may influence its bioavailability and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₆H₁₁N₃·ClH

InChI: InChI=1S/C6H11N3.ClH/c1-2-3-9-5-6(7)4-8-9;/h4-5H,2-3,7H2,1H3;1H

InChI key: InChIKey=HEKOSZRTFFCROP-UHFFFAOYSA-N

SMILES: C(CC)N1C=C(N)C=N1.Cl

Synonyms:

• 1H-Pyrazol-4-amine, 1-propyl-, hydrochloride (1:1)

1-Propylpyrazol-4-amine hydrochloride

CAS: 1390654-83-7

1-Propylpyrazol-4-amine hydrochloride

Purity: 98%

Molecular weight: 161.63g/mol

Ref: 54-OR909656

1-propyl-1H-pyrazol-4-amine hydrochloride

CAS: 1390654-83-7

Formula: C₆H₁₂ClN₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 161.63

Ref: 10-F360344