CAS 1390654-86-0

Benzo[b]thiophene-2-methanamine, 3-chloro-, hydrochloride (1:1)

Description:

Benzo[b]thiophene-2-methanamine, 3-chloro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene moiety and a methanamine group with a chlorine substituent. This compound typically appears as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the chlorine atom suggests potential reactivity and influences its biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for biological targets or having applications in organic synthesis. Its molecular structure contributes to its physical and chemical properties, including melting point, solubility, and stability under various conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a class of substances that may have significant implications in pharmaceutical research and development.

Formula: C₉H₈ClNS·ClH

InChI: InChI=1S/C9H8ClNS.ClH/c10-9-6-3-1-2-4-7(6)12-8(9)5-11;/h1-4H,5,11H2;1H

InChI key: InChIKey=ISQCRQBMNLERKE-UHFFFAOYSA-N

SMILES: ClC=1C=2C(SC1CN)=CC=CC2.Cl

Synonyms:

• Benzo[b]thiophene-2-methanamine, 3-chloro-, hydrochloride (1:1)

[(3-chloro-1-benzothien-2-yl)methyl]amine hydrochloride

CAS: 1390654-86-0

Formula: C₉H₉Cl₂NS

Purity: 95.0%

Molecular weight: 234.14

Ref: 10-F358975