CAS 1390654-99-5

3-Pyrrolidineethanamine, 1-(phenylmethyl)-, hydrochloride (1:2)

Description:

3-Pyrrolidineethanamine, 1-(phenylmethyl)-, hydrochloride (1:2), with the CAS number 1390654-99-5, is a chemical compound characterized by its amine functional group and a pyrrolidine ring. This substance typically appears as a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The compound features a phenylmethyl group, contributing to its potential biological activity and interactions. It may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. The presence of the pyrrolidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as cyclic amines often play a crucial role in drug design. Safety and handling precautions should be observed, as with many amines, due to potential irritant properties. Further studies would be necessary to fully elucidate its pharmacological profile and applications.

Formula: C₁₃H₂₀N₂·2ClH

InChI: InChI=1S/C13H20N2.2ClH/c14-8-6-13-7-9-15(11-13)10-12-4-2-1-3-5-12;;/h1-5,13H,6-11,14H2;2*1H

InChI key: InChIKey=JCKBGRLEILSJPB-UHFFFAOYSA-N

SMILES: C(N1CC(CCN)CC1)C2=CC=CC=C2.Cl

Synonyms:

• 3-Pyrrolidineethanamine, 1-(phenylmethyl)-, hydrochloride (1:2)

[2-(1-benzyl-3-pyrrolidinyl)ethyl]amine dihydrochloride

CAS: 1390654-99-5

Formula: C₁₃H₂₂Cl₂N₂

Purity: 95.0%

Molecular weight: 277.23

Ref: 10-F358985