CAS 1390655-07-8

5-Quinolinemethanamine, N-methyl-, hydrochloride (1:1)

Description:

5-Quinolinemethanamine, N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a methanamine group with a methyl substitution, contributing to its basicity and potential for forming salts, such as the hydrochloride form. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or influencing neurotransmitter systems, although specific pharmacological properties would require further investigation. Its molecular structure suggests it could participate in hydrogen bonding and other interactions, making it relevant in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical, particularly in laboratory or industrial settings.

Formula: C₁₁H₁₂N₂·ClH

InChI: InChI=1S/C11H12N2.ClH/c1-12-8-9-4-2-6-11-10(9)5-3-7-13-11;/h2-7,12H,8H2,1H3;1H

InChI key: InChIKey=SQWYZSORJXHOMA-UHFFFAOYSA-N

SMILES: C(NC)C=1C2=C(C=CC1)N=CC=C2.Cl

Synonyms:

• 5-Quinolinemethanamine, N-methyl-, hydrochloride (1:1)

N-methyl-1-(5-quinolinyl)methanamine hydrochloride

CAS: 1390655-07-8

Formula: C₁₁H₁₃ClN₂

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 208.69

Ref: 10-F360951