CAS 1390655-08-9

1H-Pyrazole, 4-(chloromethyl)-1,5-dimethyl-, hydrochloride (1:1)

Description:

1H-Pyrazole, 4-(chloromethyl)-1,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloromethyl group at the 4-position and two methyl groups at the 1 and 5 positions contributes to its unique reactivity and potential applications in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological studies and pharmaceutical formulations. The compound may exhibit various biological activities, making it of interest in drug development. Its molecular structure allows for interactions with biological targets, potentially influencing enzymatic pathways or receptor activities. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of pyrazole derivatives that may have significant implications in research and therapeutic contexts.

Formula: C₆H₉ClN₂·ClH

InChI: InChI=1S/C6H9ClN2.ClH/c1-5-6(3-7)4-8-9(5)2;/h4H,3H2,1-2H3;1H

InChI key: InChIKey=RGBJSMVONAQCKH-UHFFFAOYSA-N

SMILES: C(Cl)C1=C(C)N(C)N=C1.Cl

Synonyms:

• 1H-Pyrazole, 4-(chloromethyl)-1,5-dimethyl-, hydrochloride (1:1)

4-(chloromethyl)-1,5-dimethyl-1H-pyrazole hydrochloride

CAS: 1390655-08-9

Formula: C₆H₁₀Cl₂N₂

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 181.06

Ref: 10-F359529