CAS 1390655-09-0

Pyrrolidine, 3-(bromomethyl)-1-ethyl-, hydrobromide (1:1)

Description:

Pyrrolidine, 3-(bromomethyl)-1-ethyl-, hydrobromide (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a bromomethyl group at the 3-position and an ethyl group at the 1-position contributes to its unique reactivity and properties. As a hydrobromide salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the hydrobromide form can facilitate the compound's use in various synthetic applications, including as a reagent or intermediate in organic synthesis. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₇H₁₄BrN·BrH

InChI: InChI=1S/C7H14BrN.BrH/c1-2-9-4-3-7(5-8)6-9;/h7H,2-6H2,1H3;1H

InChI key: InChIKey=DDQCVCPWGZSICV-UHFFFAOYSA-N

SMILES: C(Br)C1CN(CC)CC1.Br

Synonyms:

• Pyrrolidine, 3-(bromomethyl)-1-ethyl-, hydrobromide (1:1)

3-(bromomethyl)-1-ethylpyrrolidine hydrobromide

CAS: 1390655-09-0

Formula: C₇H₁₅Br₂N

Purity: 95.0%

Molecular weight: 273.012

Ref: 10-F360627