CymitQuimica logo

CAS 13907-63-6

:

3,3'-(oxydibenzene-4,1-diyl)bis[1-(2-chloroethyl)-1-nitrosourea]

Description:
3,3'-(Oxydibenzene-4,1-diyl)bis[1-(2-chloroethyl)-1-nitrosourea], commonly referred to by its CAS number 13907-63-6, is a synthetic organic compound that belongs to the class of nitrosoureas, which are known for their use in cancer chemotherapy. This compound features a complex structure characterized by a central oxydibenzene moiety linked to two nitrosourea groups, each containing a chloroethyl substituent. The presence of the nitrosourea functional group imparts significant reactivity, particularly in forming DNA cross-links, which is a mechanism of action that contributes to its cytotoxic properties. The chloroethyl groups enhance its ability to alkylate DNA, making it effective against rapidly dividing cells. Additionally, the compound's solubility and stability can vary based on environmental conditions, influencing its pharmacokinetics and therapeutic efficacy. As with many nitrosoureas, it may exhibit side effects and requires careful handling due to its potential toxicity and carcinogenicity. Overall, this compound is of interest in medicinal chemistry and oncology research.
Formula:C18H18Cl2N6O5
InChI:InChI=1/C18H18Cl2N6O5/c19-9-11-25(23-29)17(27)21-13-1-5-15(6-2-13)31-16-7-3-14(4-8-16)22-18(28)26(24-30)12-10-20/h1-8H,9-12H2,(H,21,27)(H,22,28)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.