CAS 13908-43-5

N-(2-CHLOROETHYL)-N'-(4-CYANOPHENYL)UREA

Description:

N-(2-Chloroethyl)-N'-(4-cyanophenyl)urea, with the CAS number 13908-43-5, is a chemical compound that belongs to the class of ureas. This substance features a urea functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to two amine groups (NH2). The compound contains a chloroethyl group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of a cyanophenyl moiety indicates that it may exhibit interesting electronic properties and could be involved in various chemical interactions. Typically, compounds of this nature are studied for their biological activity, including potential antitumor or antimicrobial properties. Additionally, the chlorine atom in the chloroethyl group can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Overall, N-(2-chloroethyl)-N'-(4-cyanophenyl)urea is of interest in the fields of organic synthesis and pharmaceutical development due to its unique structural features and potential applications.

Formula: C₁₀H₁₀ClN₃O

InChI: InChI=1/C10H10ClN3O/c11-5-6-13-10(15)14-9-3-1-8(7-12)2-4-9/h1-4H,5-6H2,(H2,13,14,15)

SMILES: c1cc(ccc1C#N)NC(=NCCCl)O

Synonyms:

• 1-(2-Chloroethyl)-3-(4-Cyanophenyl)Urea

1-(2-Chloroethyl)-1-(4-cyanophenyl)urea

CAS: 13908-43-5

Formula: C₁₀H₁₀ClN₃O

Color and Shape: Solid

Molecular weight: 223.6589

Ref: IN-DA001A60

N-(2-Chloroethyl)-N'-(4-cyanophenyl)urea

CAS: 13908-43-5

N-(2-Chloroethyl)-N'-(4-cyanophenyl)urea

Purity: ≥95%

Molecular weight: 223.66g/mol

Ref: 54-OR12058