CAS 13908-50-4

N-(2-CHLOROETHYL)-N'-[4-(METHYLSULFANYL)PHENYL]UREA

Description:

N-(2-Chloroethyl)-N'-[4-(methylsulfanyl)phenyl]urea, with the CAS number 13908-50-4, is a chemical compound that belongs to the class of ureas. This substance features a urea functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to two amine groups (NH2). The compound is notable for its chloroethyl substituent, which can enhance its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of a methylsulfanyl group attached to a phenyl ring suggests potential interactions with biological systems, possibly influencing its pharmacological properties. The compound may exhibit moderate to high solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. As with many urea derivatives, it may also possess biological activity, making it of interest for further research in drug development and agrochemical applications. Safety and handling precautions should be observed due to the presence of chlorine and potential toxicity associated with its structure.

Formula: C₁₀H₁₃ClN₂OS

InChI: InChI=1/C10H13ClN2OS/c1-15-9-4-2-8(3-5-9)13-10(14)12-7-6-11/h2-5H,6-7H2,1H3,(H2,12,13,14)

SMILES: CSc1ccc(cc1)NC(=NCCCl)O

Synonyms:

• N-(2-Chloroethyl)-N'-[4-(methylthio)phenyl]urea
• 1-(2-Chloroethyl)-3-[4-(Methylsulfanyl)Phenyl]Urea

Urea, N-(2-chloroethyl)-N'-[4-(methylthio)phenyl]-

CAS: 13908-50-4

Formula: C₁₀H₁₃ClN₂OS

Molecular weight: 244.741

Ref: IN-DA001A78

N-(2-Chloroethyl)-N'-[4-(methylthio)phenyl]urea

CAS: 13908-50-4

N-(2-Chloroethyl)-N'-[4-(methylthio)phenyl]urea

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 244.74g/mol

Ref: 54-OR12062