CAS 139102-34-4
:Methyl 4-bromo-2-methoxybenzoate
Description:
Methyl 4-bromo-2-methoxybenzoate is an organic compound characterized by its aromatic structure, which includes a methoxy group and a bromo substituent on a benzoate framework. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the bromine atom introduces a halogen, which can enhance electrophilic substitution reactions, while the methoxy group can influence the compound's electronic properties and steric hindrance. Methyl 4-bromo-2-methoxybenzoate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. The compound's molecular structure allows for potential applications in organic synthesis, particularly in the development of more complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C9H9BrO3
InChI:InChI=1S/C9H9BrO3/c1-12-8-5-6(10)3-4-7(8)9(11)13-2/h3-5H,1-2H3
InChI key:InChIKey=WPGAGRPPDYAZAD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(OC)C=C(Br)C=C1
Synonyms:- 4-Bromo-2-methoxybenzoic acid methyl ester
- Benzoic acid, 4-bromo-2-methoxy-, methyl ester
- Methyl 4-Bromo-2-Methoxybenzoate
- Methyl 4-Bromo-2-Methoxybenzoate, Puriss
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 4-Bromo-2-methoxybenzoate
CAS:Formula:C9H9BrO3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to lumpMolecular weight:245.07Methyl 4-bromo-2-methoxybenzoate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H9BrO3Purity:98%Color and Shape:White to pale yellow, Fused solidMolecular weight:245.07Benzoic acid, 4-bromo-2-methoxy-, methyl ester
CAS:Formula:C9H9BrO3Purity:95%Color and Shape:SolidMolecular weight:245.0700Methyl 4-bromo-2-methoxybenzoate
CAS:Methyl 4-bromo-2-methoxybenzoatePurity:98%Molecular weight:245.07g/molMethyl 4-bromo-2-methoxybenzoate
CAS:Methyl 4-bromo-2-methoxybenzoate is a drug molecule that belongs to the amide class. It is a synthetic reagent and can be used as a potential precursor in the synthesis of other drugs. Methyl 4-bromo-2-methoxybenzoate has been shown to react with carboxylic acids to form methyl esters, which are functional groups that contain a carboxyl group (COOH) and an alcohol group (OH). This reaction is called methoxylation. The transformation of methyl 4-bromo-2-methoxybenzoate into methyl esters increases the solubility of the compound and allows for it to be transported in water.Formula:C9H9BrO3Purity:Min. 98 Area-%Color and Shape:Yellow PowderMolecular weight:245.07 g/molMethyl 4-bromo-2-methoxybenzoate
CAS:Formula:C9H9BrO3Purity:95%Color and Shape:SolidMolecular weight:245.072





