CymitQuimica logo

CAS 1391052-24-6

:

Benzamide, 3,4-bis(cyclopropylmethoxy)-N-(3,5-dichloro-4-pyridinyl)-

Description:
Benzamide, 3,4-bis(cyclopropylmethoxy)-N-(3,5-dichloro-4-pyridinyl)- is a synthetic organic compound characterized by its complex structure, which includes a benzamide core substituted with cyclopropylmethoxy groups and a dichloropyridine moiety. This compound typically exhibits properties associated with both amides and aromatic compounds, such as moderate solubility in organic solvents and potential biological activity due to its specific functional groups. The presence of the dichloro-4-pyridinyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The cyclopropylmethoxy substituents may influence the compound's steric and electronic properties, potentially affecting its reactivity and binding affinity in biological systems. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation in drug development and related fields.
Formula:C20H20Cl2N2O3
InChI:InChI=1S/C20H20Cl2N2O3/c21-15-8-23-9-16(22)19(15)24-20(25)14-5-6-17(26-10-12-1-2-12)18(7-14)27-11-13-3-4-13/h5-9,12-13H,1-4,10-11H2,(H,23,24,25)
InChI key:YQDXYEVCMGROIA-UHFFFAOYSA-N
SMILES:C1CC1COC2=C(C=C(C=C2)C(=O)NC3=C(C=NC=C3Cl)Cl)OCC4CC4
Found 8 products.