CAS 1391052-83-7

2′,3′-Dihydro-6′-methoxyspiro[isobenzofuran-1(3H),1′-[1H]phenalen]-3-one

Description:

2′,3′-Dihydro-6′-methoxyspiro[isobenzofuran-1(3H),1′-[1H]phenalen]-3-one is a complex organic compound characterized by its unique spirocyclic structure, which combines features of isobenzofuran and phenalen. This compound typically exhibits a range of chemical properties due to the presence of multiple functional groups, including a methoxy group and a carbonyl moiety, which can influence its reactivity and solubility. It may display interesting optical properties, making it a candidate for applications in organic electronics or photonics. The presence of the spiro linkage often contributes to its stability and can affect its conformational flexibility. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research related to materials science or medicinal chemistry. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.

Formula: C₂₁H₁₆O₃

InChI: InChI=1S/C21H16O3/c1-23-18-10-9-13-11-12-21(17-8-4-6-15(18)19(13)17)16-7-3-2-5-14(16)20(22)24-21/h2-10H,11-12H2,1H3

InChI key: InChIKey=OPICFBPAUCLDLZ-UHFFFAOYSA-N

SMILES: O=C1OC2(C=3C4=C(C(OC)=CC=C4CC2)C=CC3)C=5C1=CC=CC5

Synonyms:

• Spiro[isobenzofuran-1(3H),1′-[1H]phenalen]-3-one, 2′,3′-dihydro-6′-methoxy-
• 2′,3′-Dihydro-6′-methoxyspiro[isobenzofuran-1(3H),1′-[1H]phenalen]-3-one

2',3'-Dihydro-7-methoxy-spiro[isobenzofuran-1(3H),1'-[1H]phenalen]-3-one

Controlled Product

CAS: 1391052-83-7

Applications Intermediate in the preparation of 3-Hydroxy Benzopyrene (H829400).

Formula: C₂₁H₁₆O₃

Color and Shape: Neat

Molecular weight: 316.35

Ref: TR-D449590