CAS 1391053-28-3: Methyl 4-hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]benzoate

Description:Methyl 4-hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]benzoate, identified by its CAS number 1391053-28-3, is a chemical compound that belongs to the class of benzoates. This substance features a methyl ester functional group, which contributes to its solubility in organic solvents. The presence of a hydroxy group indicates potential for hydrogen bonding, enhancing its polarity and reactivity. The compound also contains an isopropylamino group, which may impart specific biological activity, potentially influencing its pharmacological properties. Its structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of aromatic rings in its structure may contribute to stability and lipophilicity, affecting its distribution in biological systems. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further research in drug development and related applications.

Formula:C₂₀H₂₅NO₃

InChI:InChI=1S/C20H25NO3/c1-14(2)21-12-11-17(15-7-5-4-6-8-15)18-13-16(20(23)24-3)9-10-19(18)22/h4-10,13-14,17,21-22H,11-12H2,1-3H3

InChI key:InChIKey=BXVUSHZWMYUKKK-UHFFFAOYSA-N

SMILES:O=C(OC)C1=CC=C(O)C(=C1)C(C=2C=CC=CC2)CCNC(C)C

Synonyms:
Benzoic acid, 4-hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]-, methyl ester
Methyl 4-hydroxy-3-[3-[(1-methylethyl)amino]-1-phenylpropyl]benzoate