CAS 1391053-49-8
:JKRZOJADNVOXPM-OJJJIBSVSA-N
Description:
The chemical substance with the name "JKRZOJADNVOXPM-OJJJIBSVSA-N" and CAS number "1391053-49-8" is a specific compound that can be identified through its unique structural and functional characteristics. As a member of a particular class of compounds, it may exhibit properties such as solubility, stability, and reactivity that are typical for its molecular structure. The presence of functional groups within its structure can influence its chemical behavior, including its interactions with other substances, potential biological activity, and applications in various fields such as pharmaceuticals or materials science. Additionally, the stereochemistry indicated by its name suggests that it may have specific isomeric forms, which can further affect its properties and applications. To gain a comprehensive understanding of this compound, including its synthesis, potential uses, and safety information, it is advisable to consult specialized chemical databases or literature that provide detailed insights into its characteristics and behavior in different environments.
Formula:C10H18O4
InChI:InChI=1S/C10H18O4/c1-3-5-7-13-9(11)10(12)14-8-6-4-2/h3-8H2,1-2H3/i9+1,10+1
InChI key:InChIKey=JKRZOJADNVOXPM-OJJJIBSVSA-N
SMILES:[13C]([13C](OCCCC)=O)(OCCCC)=O
Synonyms:- JKRZOJADNVOXPM-OJJJIBSVSA-N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oxalic Acid-13C2 Dibutyl Ester
CAS:Controlled ProductFormula:C2C8H18O4Color and Shape:NeatMolecular weight:204.233
