
CAS 1391054-37-7
:1-cyclopropyl-2-(2-fluorophenyl)ethane-1,2-dione
Description:
1-Cyclopropyl-2-(2-fluorophenyl)ethane-1,2-dione is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a fluorophenyl moiety attached to a diketone framework. This compound features two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the cyclopropyl ring introduces strain, which can enhance the compound's reactivity compared to more stable aliphatic systems. The fluorine atom on the phenyl ring can influence the electronic properties of the molecule, potentially affecting its interactions with biological targets or its behavior in chemical reactions. As a diketone, it may participate in various reactions, such as condensation or oxidation, making it a versatile intermediate in synthetic pathways. The compound's specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they are not universally defined and can vary based on purity and environmental conditions.
Formula:C11H9FO2
InChI:InChI=1S/C11H9FO2/c12-9-4-2-1-3-8(9)11(14)10(13)7-5-6-7/h1-4,7H,5-6H2
SMILES:c1ccc(c(c1)C(=O)C(=O)C1CC1)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Prasugrel Diketone (1-Cyclopropyl-2-(2-fluorophenyl)ethane-1,2-dione)
CAS:Ketones and quinones, w/not with other oxygen function,and their halogenated,sulfated,nitrated,or nitrosated derivatives, nesoiFormula:C11H9FO2Color and Shape:Light Yellow SolidMolecular weight:192.058661,2-Ethanedione, 1-cyclopropyl-2-(2-fluorophenyl)-
CAS:Formula:C11H9FO2Purity:98%Color and Shape:SolidMolecular weight:192.18641-Cyclopropyl-2-(2-fluorophenyl)ethane-1,2-dione
CAS:1-Cyclopropyl-2-(2-fluorophenyl)ethane-1,2-dionePurity:98%Molecular weight:192.19g/molCyclopropyl 2-Fluorophenyl Diketone
CAS:Controlled Product<p>Applications A related substance of the novel platelet inhibitor Prasugrel.<br></p>Formula:C11H9FO2Color and Shape:Yellow GreenMolecular weight:192.191-Cyclopropyl-2-(2-fluorophenyl)ethane-1,2-dione
CAS:<p>1-Cyclopropyl-2-(2-fluorophenyl)ethane-1,2-dione is a synthetic compound with the molecular formula C14H14O3. It is a diketone that has been synthesized using the oxidation of cyclopropanecarboxylic acid. Impurities are often found in this product, including ketonic compounds and carbonyl groups. This product can be used in the synthesis of prasugrel hydrochloride, which is an antiplatelet drug used to prevent blood clots after coronary stenting or percutaneous coronary intervention. The high yield and low impurity content make 1-Cyclopropyl-2-(2-fluorophenyl)ethane 1,2-dione a useful starting material for this synthesis.</p>Formula:C11H9FO2Purity:Min. 95%Molecular weight:192.19 g/mol








