CymitQuimica logo

CAS 1391054-52-6

:

2-(2,2-Diphenyl-1,3-benzodioxol-5-yl)-5-hydroxy-7-(phenylmethoxy)-4H-1-benzopyran-4-one

Description:
The chemical substance known as 2-(2,2-Diphenyl-1,3-benzodioxol-5-yl)-5-hydroxy-7-(phenylmethoxy)-4H-1-benzopyran-4-one, with the CAS number 1391054-52-6, is a complex organic compound characterized by its polycyclic structure, which includes a benzopyran core. This compound features multiple aromatic rings, contributing to its potential for strong π-π interactions and stability. The presence of hydroxyl and methoxy groups enhances its solubility and reactivity, making it of interest in various chemical applications, including medicinal chemistry and materials science. Its unique structure may impart specific biological activities, which could be explored for therapeutic purposes. Additionally, the compound's molecular configuration suggests potential for fluorescence or other optical properties, making it a candidate for studies in photochemistry. Overall, this substance exemplifies the intricate interplay of functional groups and aromatic systems in organic chemistry, highlighting its potential utility in both research and application.
Formula:C35H24O6
InChI:InChI=1S/C35H24O6/c36-28-19-27(38-22-23-10-4-1-5-11-23)20-33-34(28)29(37)21-31(39-33)24-16-17-30-32(18-24)41-35(40-30,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-21,36H,22H2
InChI key:InChIKey=KVJGSZHIKBPNQM-UHFFFAOYSA-N
SMILES:O=C1C=C(C=2C=C3OC(OC3=CC2)(C4=CC=CC=C4)C5=CC=CC=C5)OC=6C1=C(O)C=C(OCC7=CC=CC=C7)C6
Synonyms:
  • 4H-1-Benzopyran-4-one, 2-(2,2-diphenyl-1,3-benzodioxol-5-yl)-5-hydroxy-7-(phenylmethoxy)-
  • 2-(2,2-Diphenyl-1,3-benzodioxol-5-yl)-5-hydroxy-7-(phenylmethoxy)-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.