CAS 1391068-26-0

N-[4-[Bis[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-glutamic acid

Description:

N-[4-[Bis[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-glutamic acid, with CAS number 1391068-26-0, is a complex organic compound characterized by its unique structural features. It contains a pteridine moiety, which is a bicyclic compound known for its role in various biological processes, particularly in the metabolism of nucleic acids and as a cofactor in enzymatic reactions. The presence of the L-glutamic acid component suggests that this substance may have biological relevance, potentially acting as a peptide or a drug candidate. Its structure includes multiple amino groups, indicating potential for hydrogen bonding and interactions with biological macromolecules. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular conformation. Given its complexity, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific biological activities and potential applications.

Formula: C₂₆H₂₄N₁₂O₇

InChI: InChI=1S/C26H24N12O7/c27-25-34-19-17(22(42)36-25)31-12(7-29-19)9-38(10-13-8-30-20-18(32-13)23(43)37-26(28)35-20)14-3-1-11(2-4-14)21(41)33-15(24(44)45)5-6-16(39)40/h1-4,7-8,15H,5-6,9-10H2,(H,33,41)(H,39,40)(H,44,45)(H3,27,29,34,36,42)(H3,28,30,35,37,43)/t15-/m0/s1

InChI key: InChIKey=HTFSBJVLFFEYIV-HNNXBMFYSA-N

SMILES: O=C1C=2C(NC=C(CN(CC=3N=C4C(NC3)=NC(N)=NC4=O)C5=CC=C(C(N[C@@H](CCC(O)=O)C(O)=O)=O)C=C5)N2)=NC(N)=N1

Synonyms:

• N-[4-[Bis[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-glutamic acid
• L-Glutamic acid, N-[4-[bis[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-

Folic acid EP Impurity E

CAS: 1391068-26-0

Formula: C₂₆H₂₄N₁₂O₇

Molecular weight: 616.56

Ref: 4Z-F-244

Folic Acid EP Impurity E

CAS: 1391068-26-0

Formula: C₂₆H₂₄N₁₂O₇

Molecular weight: 616.56

Ref: ST-EA-CP-F5005

6-Pterinyl folic acid

CAS: 1391068-26-0

6-Pterinyl folic acid is a chemical reagent that is used in the synthesis of pteridine derivatives. It is also used to prepare sulfates and esters of folic acid. 6-Pterinyl folic acid can be synthesized by reacting glutamic anhydride with trifluoroacetic acid and dimethylformamide. It reacts with sulfate ions to produce 6-pterinyl sulfate, which can then be hydrolyzed to release 6-pterinyl folic acid. The reagent can be used in the manufacture of fluoroquinolones, antibiotics that are used to treat a variety of bacterial infections including tuberculosis.

Formula: C₂₆H₂₄N₁₂O₇

Purity: Min. 95%

Molecular weight: 616.55 g/mol

Ref: 3D-IP157350