
CAS 13911-20-1
:3,4-Dichloro-α-methoxybenzeneacetic acid
Description:
3,4-Dichloro-α-methoxybenzeneacetic acid, with the CAS number 13911-20-1, is an organic compound characterized by its aromatic structure and the presence of both chlorine and methoxy functional groups. This compound features a dichlorobenzene ring, which contributes to its chemical stability and potential reactivity. The methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its biological activity. As an acetic acid derivative, it possesses a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and acid-base reactions. The presence of chlorine atoms typically increases the compound's lipophilicity, potentially affecting its interaction with biological systems. This compound may be of interest in pharmaceutical research or as an intermediate in organic synthesis due to its unique structural features. However, specific safety and handling guidelines should be followed, as halogenated compounds can exhibit toxicity and environmental persistence.
Formula:C9H8Cl2O3
InChI:InChI=1S/C9H8Cl2O3/c1-14-8(9(12)13)5-2-3-6(10)7(11)4-5/h2-4,8H,1H3,(H,12,13)
InChI key:InChIKey=CICPXDRPEAWVIT-UHFFFAOYSA-N
SMILES:C(C(O)=O)(OC)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- DMPA
- 3,4-Dichloro-α-methoxybenzeneacetic acid
- Benzeneacetic acid, 3,4-dichloro-α-methoxy-
- Acetic acid, (3,4-dichlorophenyl)methoxy-
- (3,4-Dichlorophenyl)(methoxy)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
