CAS 13912-93-1
:5′-Guanylic acid, monoanhydride with methylenebis[phosphonic acid]
Description:
5′-Guanylic acid, monoanhydride with methylenebis[phosphonic acid], also known by its CAS number 13912-93-1, is a chemical compound that features a guanine nucleotide structure with additional phosphonic acid functionalities. This compound is characterized by its role in biochemical processes, particularly in the context of nucleotide metabolism and signaling pathways. The presence of the methylenebisphosphonic acid moiety contributes to its potential as a phosphonate, which can influence its reactivity and interaction with biological systems. The compound is typically soluble in water, reflecting the polar nature of its functional groups, and may exhibit acidic properties due to the phosphonic acid components. Its structural features allow it to participate in various biochemical reactions, making it of interest in fields such as medicinal chemistry and biochemistry. Additionally, the compound may have implications in drug design and development, particularly in targeting nucleotide-related pathways. Overall, its unique combination of guanylic acid and phosphonic acid derivatives positions it as a significant molecule in chemical and biological research.
Formula:C11H18N5O13P3
InChI:InChI=1S/C11H18N5O13P3/c12-11-14-8-5(9(19)15-11)13-2-16(8)10-7(18)6(17)4(28-10)1-27-32(25,26)29-31(23,24)3-30(20,21)22/h2,4,6-7,10,17-18H,1,3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=PHBDHXOBFUBCJD-KQYNXXCUSA-N
SMILES:O[C@H]1[C@H](N2C3=C(N=C2)C(=O)N=C(N)N3)O[C@H](COP(OP(CP(=O)(O)O)(=O)O)(=O)O)[C@H]1O
Synonyms:- 5'-Guanylylmethylenebisphosphonate
- 5'-Guanylylmethylenediphosphonate
- 5'-O-[(S)-hydroxy{[(R)-hydroxy(phosphonomethyl)phosphoryl]oxy}phosphoryl]guanosine
- 5′-Guanylic acid, monoanhydride with methylenebis[phosphonic acid]
- 5′-Guanylic acid, monoanhydride with methylenediphosphonic acid
- 5′-Guanylyl methylenediphosphonate
- 5′-Guanylyl-β,γ-methylenediphosphate
- Guanosine 5′-(β,γ-methylene)triphosphate
- Guanylyl-β,γ-methylenediphosphonate
- Phosphomethylphosphonic Acid-Guanylate Ester
- Phosphonic acid, methylenedi-, monoanhydride with 5′-guanylic acid
- β,γ-Methylene guanosine 5′-triphosphate
- β,γ-Methylene-GTP
- β,γ-Methyleneguanosine triphosphate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Guanosine-5'-[(b,gamma)-methyleno]triphosphate sodium salt
CAS:Guanosine-5'-[(b,gamma)-methyleno]triphosphate sodium salt (GMPP) is an analog of guanosine triphosphate that is enzymatically inactivated by the enzyme kinesin. GMPP inhibits the polymerization of microtubules by binding to the kinesin molecule and preventing it from binding to tubulin. GMPP has been shown to inhibit sephadex g-100 chromatography and act as a competitive inhibitor for protein synthesis in vitro. GMPP has also been shown to have a fat cell differentiation effect which may be due to its ability to inhibit microtubule polymerization.Formula:C11H18N5O13P3·xNaPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:521.21 g/mol
