CAS 139122-81-9: tripterifordin
Description:Tripterifordin, with the CAS number 139122-81-9, is a chemical compound derived from the traditional medicinal plant Tripterygium wilfordii, commonly known as Thunder God Vine. This substance is classified as a triterpenoid and exhibits a complex molecular structure characterized by multiple rings and functional groups. Tripterifordin is known for its potential pharmacological properties, including anti-inflammatory, immunosuppressive, and anticancer activities. It has been studied for its effects on various biological pathways, including the modulation of cytokine production and inhibition of cell proliferation in certain cancer types. The compound's mechanism of action may involve the disruption of signaling pathways associated with inflammation and tumor growth. Additionally, tripterifordin has garnered interest in the field of natural product chemistry due to its unique structure and potential therapeutic applications. However, further research is necessary to fully understand its efficacy, safety, and potential side effects in clinical settings.
Formula:C20H30O3
InChI:InChI=1S/C20H30O3/c1-17-7-3-8-20(12-23-16(17)21)14(17)6-9-19-10-13(4-5-15(19)20)18(2,22)11-19/h13-15,22H,3-12H2,1-2H3/t13-,14-,15-,17-,18-,19+,20+/m1/s1
InChI key:InChIKey=KLMZPLYXGZZBCX-CJSYXLNHSA-N
SMILES:O=C1OCC23CCCC1(C)C3CCC45CC(CCC42)C(O)(C)C5
- Synonyms:
- (8Alpha,10Alpha,13Alpha,16Beta)-16-Hydroxy-18,20-Epoxykauran-18-One
- (8Alpha,9Xi,10Alpha,13Alpha,16Beta)-16-Hydroxy-18,20-Epoxykauran-18-One
- 1H,3H-6a,9-Methano-4,11b-propanocyclohepta[h][2]benzopyran, kauran-18-oic acid deriv.
- Antriptolactone
- Hydroxyodolide
- Hypodiolide A
- Kauran-18-oic acid, 16,20-dihydroxy-, delta-lactone, (4alpha)-
- Kauran-18-oic acid, 16,20-dihydroxy-, δ-lactone, (4α)-
