CAS 139143-09-2
:Bisiisopropylphenylimidazoliumchloride
Description:
Bisiisopropylphenylimidazolium chloride, identified by its CAS number 139143-09-2, is an ionic liquid that belongs to the class of imidazolium salts. This compound features a bulky bisiisopropyl substituent on the imidazolium ring, which contributes to its unique properties, such as low volatility and high thermal stability. Ionic liquids like this one are characterized by their ability to dissolve a wide range of organic and inorganic materials, making them useful as solvents in various chemical reactions and processes. Additionally, they often exhibit low toxicity and are considered environmentally friendly alternatives to traditional organic solvents. The presence of the chloride anion in this compound can influence its solubility and reactivity. Bisiisopropylphenylimidazolium chloride is of interest in fields such as catalysis, electrochemistry, and materials science due to its tunable properties and potential applications in green chemistry. Its specific characteristics, such as melting point, viscosity, and conductivity, can vary based on the conditions and the presence of other substances.
Formula:C9H17ClN2
InChI:InChI=1/C9H17N2.ClH/c1-8(2)10-5-6-11(7-10)9(3)4;/h5-9H,1-4H3;1H/q+1;/p-1
Synonyms:- 1,3-Bis(2,6-di-isopropylphenyl)imidazolium chloride
- 1,3-di(propan-2-yl)-1H-imidazol-3-ium chloride
- 1,3-Diisopropylimidazolium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3-Diisopropylimidazolium chloride, 97+%
CAS:Ligand for ruthenium-catalyzed greener amide bond formation by dehydrogenative coupling of amines and alcohols. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original
Formula:C9H17ClN2Purity:97+%Color and Shape:White to pale brown, Crystals or powder or crystalline powderMolecular weight:188.691H-Imidazolium, 1,3-bis(1-methylethyl)-, chloride (1:1)
CAS:Formula:C9H17ClN2Purity:96%Color and Shape:SolidMolecular weight:188.69771,3-Diisopropylimidazolium chloride
CAS:1,3-Diisopropylimidazolium chloridePurity:99%Molecular weight:188.70g/mol



