CAS 1391499-52-7: (2S,6S)-2-[(4-Bromo-2,5-dimethoxyphenyl)methyl]-6-(2-methoxyphenyl)piperidine

Description:The chemical substance known as (2S,6S)-2-[(4-Bromo-2,5-dimethoxyphenyl)methyl]-6-(2-methoxyphenyl)piperidine, with CAS number 1391499-52-7, is a piperidine derivative characterized by its complex structure that includes a piperidine ring substituted with various aromatic groups. The presence of bromine and methoxy groups indicates potential for significant biological activity, as these substituents can influence the compound's interaction with biological targets. The stereochemistry, denoted by the (2S,6S) configuration, suggests specific spatial arrangements that may affect the compound's pharmacological properties. This compound may exhibit properties relevant to medicinal chemistry, particularly in the context of neuropharmacology, due to its structural similarity to known psychoactive substances. Its solubility, stability, and reactivity would depend on the functional groups present, and it may be of interest in research related to drug development or synthesis. However, detailed studies would be necessary to elucidate its specific properties and potential applications.

Formula:C₂₁H₂₆BrNO₃

InChI:InChI=1S/C21H26BrNO3/c1-24-19-10-5-4-8-16(19)18-9-6-7-15(23-18)11-14-12-21(26-3)17(22)13-20(14)25-2/h4-5,8,10,12-13,15,18,23H,6-7,9,11H2,1-3H3/t15-,18-/m0/s1

InChI key:InChIKey=KMVGLBONODPTDY-YJBOKZPZSA-N

SMILES:BrC=1C=C(OC)C(=CC1OC)CC2NC(C=3C=CC=CC3OC)CCC2

Synonyms:
Piperidine, 2-[(4-bromo-2,5-dimethoxyphenyl)methyl]-6-(2-methoxyphenyl)-, (2S,6S)-
(2S,6S)-2-[(4-Bromo-2,5-dimethoxyphenyl)methyl]-6-(2-methoxyphenyl)piperidine