CAS 139157-06-5
:5H-Pyrrolo[3,4-b]pyridine-5,7(6H)-dione, 6-(4-acetylphenyl)-
Description:
5H-Pyrrolo[3,4-b]pyridine-5,7(6H)-dione, 6-(4-acetylphenyl)-, with the CAS number 139157-06-5, is a heterocyclic organic compound characterized by a fused pyrrole and pyridine ring system. This compound features a diketone structure, which contributes to its reactivity and potential biological activity. The presence of the 4-acetylphenyl substituent enhances its molecular complexity and may influence its solubility and interaction with biological targets. Typically, such compounds exhibit a range of properties, including potential pharmacological activities, which can be attributed to their ability to interact with various biological pathways. The compound may also display distinct spectroscopic characteristics, such as UV-Vis and NMR spectra, which can be utilized for its identification and characterization. Its synthesis and derivatives are of interest in medicinal chemistry, particularly for their potential applications in drug development. Overall, this compound exemplifies the diverse chemistry of heterocycles and their significance in pharmaceutical research.
Formula:C15H10N2O3
InChI:InChI=1S/C15H10N2O3/c1-9(18)10-4-6-11(7-5-10)17-14(19)12-3-2-8-16-13(12)15(17)20/h2-8H,1H3
InChI key:KPELNMZBEXSMGS-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC=C(C=C1)N2C(=O)C3=C(C2=O)N=CC=C3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
6-(4-Acetylphenyl)-5h-pyrrolo[3,4-b]pyridine-5,7(6h)-dione
CAS:Formula:C15H10N2O3Molecular weight:266.2515
