CymitQuimica logo

CAS 13916-98-8

:

8-FLUORO-2-NAPHTHOL

Description:
8-Fluoro-2-naphthol is an organic compound characterized by the presence of a fluorine atom and a hydroxyl group attached to a naphthalene ring system. Its molecular structure features a naphthalene backbone, which consists of two fused benzene rings, with the hydroxyl (-OH) group located at the 2-position and the fluorine atom at the 8-position. This compound is typically a white to off-white solid and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the fluorine atom can influence the compound's reactivity, solubility, and biological activity. 8-Fluoro-2-naphthol may exhibit properties such as moderate to high lipophilicity, which can affect its interaction with biological systems. Additionally, it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable building block in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H7FO
InChI:InChI=1/C10H7FO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-6,12H
InChI key:BBPLRENRRYYWPO-UHFFFAOYSA-N
SMILES:c1cc2ccc(cc2c(c1)F)O
Synonyms:
  • 8-Fluoronaphthalen-2-Ol
Found 4 products.