CAS 13917-61-8
:1-(naphthalen-1-yloxy)propan-2-one
Description:
1-(Naphthalen-1-yloxy)propan-2-one, with the CAS number 13917-61-8, is an organic compound characterized by its structure, which includes a naphthalene moiety linked to a propan-2-one group via an ether bond. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the naphthalene ring. It is likely to be soluble in organic solvents, such as ethanol and acetone, while having limited solubility in water due to its hydrophobic nature. The compound may exhibit interesting chemical reactivity, including potential electrophilic substitution reactions on the aromatic ring and nucleophilic reactions at the carbonyl group. Its applications could span various fields, including organic synthesis and materials science, particularly in the development of dyes or pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H12O2
InChI:InChI=1/C13H12O2/c1-10(14)9-15-13-8-4-6-11-5-2-3-7-12(11)13/h2-8H,9H2,1H3
Synonyms:- 1-(1-Naphthyloxy)acetone
- 2-propanone, 1-(1-naphthalenyloxy)-
- 2-Propanone, 1- (1-naphthalenyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
