CAS 13918-92-8
:2,4-difluorobenzenesulfonyl chloride
Description:
2,4-Difluorobenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that has two fluorine substituents at the 2 and 4 positions. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The presence of fluorine atoms enhances its electrophilic character, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 2,4-difluorobenzenesulfonyl chloride is sensitive to moisture and should be handled with care, as it can hydrolyze to form the corresponding sulfonic acid. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound due to its corrosive nature and potential health hazards.
Formula:C6H3ClF2O2S
InChI:InChI=1/C6H3ClF2O2S/c7-12(10,11)6-2-1-4(8)3-5(6)9/h1-3H
SMILES:c1cc(c(cc1F)F)S(=O)(=O)Cl
Synonyms:- 2,4-Difluorobenzene-1-sulfonyl chloride
- 2,4-Difluorobenzenesulphonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4-Difluorobenzenesulfonyl Chloride
CAS:Formula:C6H3ClF2O2SPurity:>98.0%(GC)(T)Color and Shape:Colorless to Yellow clear liquidMolecular weight:212.592,4-Difluorobenzenesulfonyl chloride, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H3ClF2O2SPurity:98%Color and Shape:Liquid, Clear colorless to yellowMolecular weight:212.59Benzenesulfonyl chloride, 2,4-difluoro-
CAS:Formula:C6H3ClF2O2SPurity:98%Color and Shape:LiquidMolecular weight:212.60162,4-Difluorobenzenesulphonyl chloride
CAS:2,4-Difluorobenzenesulphonyl chlorideFormula:C6H3ClF2O2SPurity:98%Color and Shape: clear. faint yellow liquidMolecular weight:212.60162g/mol2,4-Difluorobenzenesulfonyl chloride
CAS:Formula:C6H3ClF2O2SPurity:98%Color and Shape:ClearMolecular weight:212.59





