CymitQuimica logo

CAS 1392211-51-6

:

7-Azaspiro[3.5]nonan-2-one hydrochloride

Description:
7-Azaspiro[3.5]nonan-2-one hydrochloride is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in the ring system. This compound features a bicyclic framework that contributes to its potential biological activity. The presence of the ketone functional group (2-one) indicates that it has a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting central nervous system disorders or other therapeutic areas. Its specific interactions and efficacy would depend on further studies, including pharmacological profiling and structure-activity relationship assessments. Overall, 7-Azaspiro[3.5]nonan-2-one hydrochloride represents a class of compounds that may hold promise in drug discovery and development due to their structural uniqueness and potential biological activities.
Formula:C8H14ClNO
InChI:InChI=1S/C8H13NO.ClH/c10-7-5-8(6-7)1-3-9-4-2-8;/h9H,1-6H2;1H
InChI key:HTUYLSSIULJILZ-UHFFFAOYSA-N
SMILES:C1CNCCC12CC(=O)C2.Cl
Found 4 products.