CAS 1392274-35-9

1′-Methyl[3,4′-bi-1H-pyrazole]-3′-carboxylic acid

Description:

1′-Methyl[3,4′-bi-1H-pyrazole]-3′-carboxylic acid is a chemical compound characterized by its unique structure, which includes a bi-pyrazole framework. This compound features two pyrazole rings connected by a carbon-carbon bond, with a methyl group and a carboxylic acid functional group attached to the structure. The presence of the carboxylic acid group contributes to its acidic properties, making it potentially useful in various chemical reactions and applications. The methyl group can influence the compound's solubility and reactivity. Additionally, the bi-pyrazole structure may impart interesting biological activities, making it a subject of interest in medicinal chemistry. The compound's CAS number, 1392274-35-9, allows for easy identification and reference in chemical databases. Overall, 1′-Methyl[3,4′-bi-1H-pyrazole]-3′-carboxylic acid is notable for its structural complexity and potential applications in research and industry.

Formula: C₈H₈N₄O₂

InChI: InChI=1S/C8H8N4O2/c1-12-4-5(6-2-3-9-10-6)7(11-12)8(13)14/h2-4H,1H3,(H,9,10)(H,13,14)

InChI key: InChIKey=LCWWXNMPMDOYBS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN(C)N1)C=2C=CNN2

Synonyms:

• [3,4′-Bi-1H-pyrazole]-3′-carboxylic acid, 1′-methyl-
• 1′-Methyl[3,4′-bi-1H-pyrazole]-3′-carboxylic acid

1-Methyl-4-(1H-pyrazol-3-yl)-1H-pyrazole-3-carboxylic acid

CAS: 1392274-35-9

Versatile small molecule scaffold

Formula: C₈H₈N₄O₂

Purity: Min. 95%

Molecular weight: 192.17 g/mol

Ref: 3D-SFC27435