CAS 1392488-07-1

3H-Indolium, 2-[2-(2,3-dihydro-6-hydroxy-5,7-disulfo-1H-xanthen-4-yl)ethenyl]-1,3,3-trimethyl-, inner salt

Description:

3H-Indolium, 2-[2-(2,3-dihydro-6-hydroxy-5,7-disulfo-1H-xanthen-4-yl)ethenyl]-1,3,3-trimethyl-, inner salt is a complex organic compound characterized by its indolium structure, which features a positively charged nitrogen atom within a fused ring system. This compound contains multiple functional groups, including sulfonic acid groups, which enhance its solubility in water and contribute to its potential applications in biological systems. The presence of the xanthene moiety suggests that it may exhibit fluorescent properties, making it useful in various imaging and sensing applications. Additionally, the hydroxyl groups may impart antioxidant properties, while the trimethyl groups can influence its steric and electronic characteristics. Overall, this compound's unique structural features and functional groups position it as a candidate for research in fields such as biochemistry, materials science, and photonics. Its specific interactions and reactivity would depend on the surrounding environment and conditions, making it a subject of interest for further investigation.

Formula: C₂₆H₂₅NO₈S₂

InChI: InChI=1S/C26H25NO8S2/c1-26(2)18-9-4-5-10-19(18)27(3)21(26)12-11-15-7-6-8-16-13-17-14-20(36(29,30)31)22(28)25(37(32,33)34)24(17)35-23(15)16/h4-5,9-14H,6-8H2,1-3H3,(H2,29,30,31,32,33,34)

InChI key: InChIKey=QPJLDQIEJYZMPZ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=C2C(=CC(S(=O)(=O)[O-])=C1O)C=C3C(O2)=C(C=CC=4C(C)(C)C=5C([N+]4C)=CC=CC5)CCC3

Synonyms:

• 3H-Indolium, 2-[2-(2,3-dihydro-6-hydroxy-5,7-disulfo-1H-xanthen-4-yl)ethenyl]-1,3,3-trimethyl-, inner salt

NIR dye-1

CAS: 1392488-07-1

NIR dye-1 is a near-infrared (NIR) fluorescent dye which has absorption and emission in the NIR region while retaining an optically tunable hydroxyl group.

Formula: C₂₆H₂₅NO₈S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 543.61

Ref: TM-T19037