CymitQuimica logo

CAS 139264-66-7

:

(S)-4-(4'-Nitrobenzyl)-1,3-oxazolidine-2-one

Description:
(S)-4-(4'-Nitrobenzyl)-1,3-oxazolidine-2-one is a chiral compound characterized by its oxazolidine ring structure, which contributes to its potential biological activity. The presence of the nitrobenzyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its stereochemistry, indicated by the (S) configuration, is crucial for its biological activity, as enantiomers can exhibit different pharmacological effects. The oxazolidine-2-one moiety is known for its role in various chemical reactions, including cycloadditions and as a building block for more complex molecules. Additionally, the compound's stability and solubility in organic solvents make it suitable for various applications in research and development. Safety data should be consulted for handling and usage, as compounds with nitro groups can pose specific hazards. Overall, (S)-4-(4'-Nitrobenzyl)-1,3-oxazolidine-2-one is a valuable compound in the field of synthetic organic chemistry.
Formula:C10H10N2O4
InChI:InChI=1/C10H10N2O4/c13-10-11-8(6-16-10)5-7-1-3-9(4-2-7)12(14)15/h1-4,8H,5-6H2,(H,11,13)/t8-/m0/s1
SMILES:c1cc(ccc1C[C@H]1COC(=N1)O)N(=O)=O
Synonyms:
  • (R)-(+)-4-(4-Nitrobenzyl)-2-Oxazolidinone
  • (S)-4-(4'-Nitrobenzyl)-1,3-Oxazolidin-2-One
  • (S)-4-(4-Nitrobenzyl)-2-Oxazolidinone
  • (4S)-4-(4-nitrobenzyl)-1,3-oxazolidin-2-one
  • (S)-4-(4'-NITROBENZYL)-1,3-OXAZOLIDINE-2-ONE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.