CAS 139272-66-5
:(2-methoxy-2-oxo-ethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate
Description:
The chemical substance known as (2-methoxy-2-oxo-ethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate, with the CAS number 139272-66-5, is characterized by its complex molecular structure, which includes functional groups such as an ester and a methoxy group. This compound typically exhibits moderate to high lipophilicity due to the presence of aromatic rings and halogen substituents, which can influence its solubility and reactivity. The dichloroaniline moiety suggests potential biological activity, possibly as a pharmaceutical or agrochemical agent. Its molecular weight and specific physical properties, such as melting point and boiling point, would depend on the arrangement of atoms and intermolecular forces. Additionally, the presence of chlorine atoms may impart unique electronic properties, affecting its interaction with biological targets. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and material science, where its reactivity and biological activity can be further explored.
Formula:C17H15Cl2NO4
InChI:InChI=1/C17H15Cl2NO4/c1-23-16(22)10-24-15(21)9-11-5-2-3-8-14(11)20-17-12(18)6-4-7-13(17)19/h2-8,20H,9-10H2,1H3
SMILES:COC(=O)COC(=O)Cc1ccccc1Nc1c(cccc1Cl)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-, 2-methoxy-2-oxoethyl ester
CAS:Formula:C17H15Cl2NO4Purity:97%Color and Shape:SolidMolecular weight:368.2113Aceclofenac EP Impurity D
CAS:Formula:C17H15Cl2NO4Color and Shape:White To Off-White SolidMolecular weight:368.222-Methoxy-2-oxoethyl 2-(2-((2,6-dichlorophenyl)amino)phenyl)acetate
CAS:2-Methoxy-2-oxoethyl 2-(2-((2,6-dichlorophenyl)amino)phenyl)acetatePurity:97%Molecular weight:368.22g/molAceclofenac methyl ester
CAS:Aceclofenac methyl ester belongs to the aryl propionic acid derivativesFormula:C17H15Cl2NO4Color and Shape:SolidMolecular weight:368.21Aceclofenac EP Impurity D
CAS:Controlled ProductFormula:C17H15Cl2NO4Color and Shape:NeatMolecular weight:368.21Aceclofenac Methyl Ester
CAS:Controlled ProductImpurity Aceclofenac EP Impurity D
Applications Aceclofenac Methyl Ester (Aceclofenac EP Impurity D) is a 2-[(2,6-dichlorophenyl)amino]phenylacetoxyacetyl derivative as anti-inflammmatory and analgesic agent.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C17H15Cl2NO4Color and Shape:Off-WhiteMolecular weight:368.21Aceclofenac methyl ester
CAS:Aceclofenac methyl ester is an analgesic that belongs to the arylpropionic acid derivatives. It has been developed for the treatment of acute pain. Aceclofenac methyl ester has a structural formula of CH3CO-O-CH3 and a molecular weight of 164.2 g/mol. Aceclofenac is metabolized by CYP450 enzymes, which are located in the liver and other organs, to form acetic acid and 5-hydroxyaceclofenac. The reaction time is approximately 1 hour and tetrahydrofuranyl (THF) is used as a nucleophile in this reaction. This product can be synthesized by reacting ethyl acetate with acetonitrile in high yield, making it stable and anhydrous. The analgesic effects of aceclofenac methyl ester are due to its ability to block the transmission of pain signals from nerves to the brain at the spinal cord levelFormula:C17H15Cl2NO4Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:368.21 g/mol







