CymitQuimica logo

CAS 13928-68-2

:

1,3-Dimethyl-5,7-adamantanedicarboxylic acid

Description:
1,3-Dimethyl-5,7-adamantanedicarboxylic acid, with the CAS number 13928-68-2, is a bicyclic organic compound characterized by its adamantane structure, which consists of a diamond-like arrangement of carbon atoms. This compound features two carboxylic acid functional groups (-COOH) located at the 5 and 7 positions, along with two methyl groups (-CH3) at the 1 and 3 positions of the adamantane framework. The presence of these functional groups contributes to its solubility and reactivity, making it a potential candidate for various chemical applications, including as a building block in organic synthesis and materials science. The compound is typically solid at room temperature and exhibits moderate melting and boiling points, indicative of its molecular structure. Its unique arrangement allows for interesting interactions in biological systems and materials, potentially influencing its behavior in different environments. Overall, 1,3-Dimethyl-5,7-adamantanedicarboxylic acid is notable for its structural complexity and functional versatility.
Formula:C14H20O4
InChI:InChI=1/C14H20O4/c1-11-3-12(2)6-13(4-11,9(15)16)8-14(5-11,7-12)10(17)18/h3-8H2,1-2H3,(H,15,16)(H,17,18)
SMILES:CC12CC3(C)CC(C1)(CC(C2)(C3)C(=O)O)C(=O)O
Synonyms:
  • 5,7-Dimethyltricyclo[3.3.1.1~3,7~]Decane-1,3-Dicarboxylic Acid
  • 5,7-Dimethyladamantane-1,3-Dicarboxylic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.