CAS 1392804-34-0

Cyclobutanecarboxylic acid, 3-amino-2,2-dimethyl-, methyl ester, hydrochloride (1:1)

Description:

Cyclobutanecarboxylic acid, 3-amino-2,2-dimethyl-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its cyclobutane ring structure, which contributes to its unique physical and chemical properties. The presence of a carboxylic acid functional group and an amino group indicates that it can participate in various chemical reactions, including esterification and amination. The methyl ester form suggests that it is a derivative of cyclobutanecarboxylic acid, enhancing its solubility in organic solvents. The hydrochloride salt form indicates that the compound is protonated, which can improve its stability and solubility in aqueous solutions. This compound may exhibit biological activity due to the presence of the amino group, potentially interacting with biological targets. Its molecular structure allows for various applications in organic synthesis and medicinal chemistry. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Overall, this compound represents a versatile building block in chemical research and development.

Formula: C₈H₁₅NO₂·ClH

InChI: InChI=1S/C8H15NO2.ClH/c1-8(2)5(4-6(8)9)7(10)11-3;/h5-6H,4,9H2,1-3H3;1H

InChI key: InChIKey=YNGIJCQPNBJXTP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C(C)(C)C(N)C1.Cl

Synonyms:

• Cyclobutanecarboxylic acid, 3-amino-2,2-dimethyl-, methyl ester, hydrochloride (1:1)

Methyl 3-amino-2,2-dimethylcyclobutanecarboxylate hydrochloride

CAS: 1392804-34-0

Formula: C₈H₁₆ClNO₂

Molecular weight: 193.6711

Ref: IN-DA001AOA