CymitQuimica logo

CAS 139290-71-4

:

1,1-Dimethylethyl 4-(2,3-dimethoxybenzoyl)-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-(2,3-dimethoxybenzoyl)-1-piperidinecarboxylate, with the CAS number 139290-71-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzoyl moiety with methoxy substituents. This compound typically exhibits properties associated with both lipophilicity and potential biological activity due to the presence of the piperidine and aromatic groups. The dimethoxy substitution on the benzoyl group may influence its reactivity and interaction with biological targets. As an ester, it may undergo hydrolysis under certain conditions, releasing the corresponding piperidinecarboxylic acid and alcohol. The compound's specific applications and behavior in various chemical environments can vary, but it is often studied for its potential pharmacological properties. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its structure and purity. Overall, this compound represents a class of organic molecules that may have significance in medicinal chemistry and drug development.
Formula:C19H27NO5
InChI:InChI=1S/C19H27NO5/c1-19(2,3)25-18(22)20-11-9-13(10-12-20)16(21)14-7-6-8-15(23-4)17(14)24-5/h6-8,13H,9-12H2,1-5H3
InChI key:InChIKey=ASGQPSLNQQAJOW-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C(OC)=CC=C1)C2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1,1-Dimethylethyl 4-(2,3-dimethoxybenzoyl)-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-(2,3-dimethoxybenzoyl)-, 1,1-dimethylethyl ester
  • 4-(2,3-Dimethoxybenzoyl)-1-piperidinecarboxylic acid 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.