CAS 139301-27-2
:4-(Trifluoromethoxy)benzeneboronic acid
Description:
4-(Trifluoromethoxy)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring that is further substituted with a trifluoromethoxy group. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents. The trifluoromethoxy group enhances its reactivity and polarity, making it useful in various chemical reactions, particularly in Suzuki coupling reactions, which are pivotal in organic synthesis for forming carbon-carbon bonds. The boronic acid moiety allows for the formation of stable complexes with diols, which is advantageous in applications such as drug development and materials science. Additionally, the presence of fluorine atoms contributes to its unique electronic properties, potentially influencing its reactivity and interaction with biological systems. Overall, 4-(Trifluoromethoxy)benzeneboronic acid is a valuable compound in synthetic organic chemistry, particularly in the development of pharmaceuticals and advanced materials.
Formula:C7H6BF3O3
InChI:InChI=1/C7H6BF3O3/c9-7(10,11)14-6-3-1-5(2-4-6)8(12)13/h1-4,12-13H
SMILES:c1cc(ccc1B(O)O)OC(F)(F)F
Synonyms:- 4-(Trifluoromethoxy)Phenylboronic Acid
- P-Trifluoromethoxy Benzoboric Acid
- P-(Trifluoromethoxy)Phenylboronic Acid
- 4-(Trifluoromethoxy)phenylboronicacid(containsvaryingamountsofanhydride)
- 4-(Trifluoromethoxy)phenylboronic aicd
- 4-Trifluoromethoxyphenylboronic acid
- 4-[(Trifluoromethoxy)-Phenyl]-Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H6BF3O3Color and Shape:White to Orange to Green powder to crystalMolecular weight:205.93Boronic acid, B-[4-(trifluoromethoxy)phenyl]-
CAS:Formula:C7H6BF3O3Purity:98%Color and Shape:SolidMolecular weight:205.92694-(Trifluoromethoxy)benzeneboronic acid
CAS:4-(Trifluoromethoxy)benzeneboronic acidFormula:C7H6BF3O3Purity:98%Color and Shape: white solidMolecular weight:205.93g/mol4-(Trifluoromethoxy)benzeneboronic acid
CAS:Formula:C7H6BF3O3Purity:98%Color and Shape:Solid, CrystallineMolecular weight:205.934-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:4-(Trifluoromethoxy)phenylboronic acid is a boron-containing compound that has been shown to be a potent inhibitor of the histone deacetylase (HDAC) enzyme. It also has surfactant properties and can be used as a photochemical reagent. 4-(Trifluoromethoxy)phenylboronic acid is orally bioavailable and may have therapeutic potential for neurodegenerative diseases, such as Alzheimer's disease, Parkinson's disease, and Huntington's disease. It also has the ability to inhibit cancer cell growth by inhibiting HDAC activity. This drug has been found to cross-couple with organosilicon compounds in order to form new compounds with potent inhibitory activity against HDAC enzymes.
Formula:C7H6BF3O3Purity:Min. 95%Molecular weight:205.93 g/mol





