CAS 139305-96-7

(S)-1-(3-Bromophenyl)ethylamine

Description:

(S)-1-(3-Bromophenyl)ethylamine is an organic compound characterized by its chiral structure, featuring a brominated phenyl group attached to an ethylamine backbone. The presence of the bromine atom at the meta position of the phenyl ring influences its reactivity and physical properties, such as solubility and boiling point. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits basic properties due to the amine functional group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The chirality of the molecule is significant in biological contexts, as it may interact with biological receptors or enzymes in a stereospecific manner. This compound is of interest in medicinal chemistry and research, particularly in the development of pharmaceuticals, where the specific stereochemistry can affect the efficacy and safety of drug candidates. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₁₀BrN

InChI: InChI=1/C8H10BrN/c1-6(10)7-3-2-4-8(9)5-7/h2-6H,10H2,1H3/t6-/m0/s1

SMILES: C[C@@H](c1cccc(c1)Br)N

Synonyms:

• (S)-3-Bromo-Alpha-Methylbenzylamine
• (S)-(-)-3-Bromo A-Methylbenzylamine
• (S)-1-(3-Bromophenyl)Ethanamine
• 3-Bromo-Alpha-Methylbenzylamine
• (S)-(-)-3-Bromo-Alpha-Methylbenzylamine Hydrochloride
• Benzenemethanamine, 3-bromo-α-methyl-, (αS)-
• (1S)-1-(3-bromophenyl)ethanamine

Benzenemethanamine, 3-bromo-α-methyl-, (αS)-

CAS: 139305-96-7

Formula: C₈H₁₀BrN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 200.0757

Ref: IN-DA001AQD

(1S)-1-(3-Bromophenyl)ethanamine

CAS: 139305-96-7

(1S)-1-(3-Bromophenyl)ethanamine

Formula: C₈H₁₀BrN

Purity: 97%

Color and Shape: orange liquid

Molecular weight: 200.08g/mol

Ref: 54-OR914411

(S)-1-(3-Bromophenyl)ethanamine

CAS: 139305-96-7

Formula: C₈H₁₀BrN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 200.079

Ref: 10-F221654

(S)-3-Bromo-±-methylbenzylamine

CAS: 139305-96-7

Versatile small molecule scaffold

Formula: C₈H₁₀BrN

Purity: Min. 95%

Molecular weight: 200.08 g/mol

Ref: 3D-PFA30596