CAS 139332-66-4
:4-Nitro-7-(1-piperazinyl)-2,1,3-benzoxadiazole
Description:
4-Nitro-7-(1-piperazinyl)-2,1,3-benzoxadiazole is a chemical compound characterized by its unique structure, which includes a benzoxadiazole core substituted with a nitro group and a piperazine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and pharmacological research. The presence of the nitro group can influence its electronic properties and reactivity, while the piperazine ring may contribute to its interaction with biological targets. Additionally, the compound may exhibit fluorescence, which can be useful in various applications, including imaging and sensing. Its molecular structure suggests potential applications in drug development, particularly in targeting specific receptors or pathways in biological systems. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, 4-Nitro-7-(1-piperazinyl)-2,1,3-benzoxadiazole represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C10H11N5O3
InChI:InChI=1/C10H11N5O3/c16-15(17)8-2-1-7(9-10(8)13-18-12-9)14-5-3-11-4-6-14/h1-2,11H,3-6H2
SMILES:c1cc(c2c(c1N1CCNCC1)non2)N(=O)=O
Synonyms:- 4-Nitro-7-Piperazino-2,1,3-Benzoxadiazole
- 4-Nitro-7-Piperazinobenzofurazan
- Nbd-Pz
- Nbd-Pz(=4-Nitro-7-Piperazino-2,1,3-Benzoxadiazole)[For Hplc Labeling]
- nbd-pzforHPLClabeling
- 4-Nitro-7-Piperazino-2,1,3-Benzoxadiazole, Nbd-Pz, For Hplc Labeling
- 4-Nitro-7-Piperazin-1-Yl-2,1,3-Benzoxadiazole
- 4-NITRO-7-(1-PIPERAZINYL)-2,1,3-BENZOXADIAZOLE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
NBD-PZ (=4-Nitro-7-piperazino-2,1,3-benzoxadiazole) [for HPLC Labeling]
CAS:Formula:C10H11N5O3Purity:>98.0%(T)(HPLC)Color and Shape:Dark red to Brown powder to crystalMolecular weight:249.234-Nitro-7-(piperazin-1-yl)benzo[c][1,2,5]oxadiazole
CAS:Formula:C10H11N5O3Purity:98%Color and Shape:SolidMolecular weight:249.22604-Nitro-7-Piperazino-2,1,3-Benzoxadiazole
CAS:4-Nitro-7-Piperazino-2,1,3-BenzoxadiazolePurity:98%Molecular weight:249.23g/mol4-Nitro-7-(1-piperazinyl)-2,1,3-benzoxadiazole
CAS:4-Nitro-7-(1-piperazinyl)-2,1,3-benzoxadiazole is an analytical method for the determination of human serum and heart tissue. The dextran sulfate derivative of 4-nitro-7-(1-piperazinyl)-2,1,3-benzoxadiazole is fluorescent and reacts with trifluoroacetic acid to form a fluorescent derivative. This fluorescent derivative can be detected by spectrophotometry at excitation and emission wavelengths of 350 nm and 400 nm respectively. 4N7PB binds to fatty acids in biological samples (e.g., serum) through its piperazine moiety and fluoresces when excited by light at 340 nm. This reaction can be used as a probe for the presence of fatty acid metabolites in blood or other body fluids such as urine or cerebrospinal fluid. Chemical structures include: 4N7PB cis-(Formula:C10H11N5O3Purity:Min. 95%Color and Shape:SolidMolecular weight:249.23 g/mol





