CAS 1393330-37-4

2,3,4,5,6-Pentafluorophenyl 3-[2-(2-azidoethoxy)ethoxy]propanoate

Description:

2,3,4,5,6-Pentafluorophenyl 3-[2-(2-azidoethoxy)ethoxy]propanoate is a chemical compound characterized by its complex structure, which includes a pentafluorophenyl group and an azidoethoxy moiety. The presence of five fluorine atoms on the phenyl ring significantly enhances its electron-withdrawing properties, making it highly reactive and potentially useful in various chemical reactions, particularly in the synthesis of fluorinated compounds. The azido group (-N3) is known for its utility in click chemistry, allowing for the formation of stable linkages with other molecules, which can be advantageous in drug development and materials science. The ethoxy groups contribute to the compound's solubility and reactivity, facilitating interactions with biological systems or other chemical entities. Overall, this compound's unique combination of functional groups and fluorination makes it a valuable candidate for research in organic synthesis, medicinal chemistry, and materials science. However, handling should be approached with caution due to the potential hazards associated with azides and fluorinated compounds.

Formula: C₁₃H₁₂F₅N₃O₄

InChI: InChI=1S/C13H12F5N3O4/c14-8-9(15)11(17)13(12(18)10(8)16)25-7(22)1-3-23-5-6-24-4-2-20-21-19/h1-6H2

InChI key: InChIKey=FEXHEMGARNABFF-UHFFFAOYSA-N

SMILES: O(C(CCOCCOCCN=[N+]=[N-])=O)C1=C(F)C(F)=C(F)C(F)=C1F

Synonyms:

• 2,3,4,5,6-Pentafluorophenyl 3-[2-(2-azidoethoxy)ethoxy]propanoate
• Propanoic acid, 3-[2-(2-azidoethoxy)ethoxy]-, 2,3,4,5,6-pentafluorophenyl ester

N3-PEG2-C2-PFP ester

CAS: 1393330-37-4

The N3-PEG2-C2-PFP ester, a nonclaevable 2-unit polyethylene glycol (PEG) linker, is commonly employed in the synthesis of antibody-drug conjugates (ADCs).

Formula: C₁₃H₁₂F₅N₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 369.24

Ref: TM-T16254