CAS 1393330-40-9: 2,5-Dioxo-1-pyrrolidinyl 4,7,10,13,16-pentaoxanonadec-18-ynoate

Description:2,5-Dioxo-1-pyrrolidinyl 4,7,10,13,16-pentaoxanonadec-18-ynoate, with the CAS number 1393330-40-9, is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and multiple ether linkages due to the presence of pentaoxanonadecane moieties. This compound features both keto and ester functional groups, contributing to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of multiple oxygen atoms in its structure suggests that it may exhibit hydrophilic properties, influencing its solubility in polar solvents. Additionally, the ynoate group indicates the presence of an alkyne, which may allow for further chemical modifications or reactions. The compound's unique structural features may also impart specific biological activities, making it of interest for research in drug development or as a potential therapeutic agent. However, detailed studies on its physical properties, stability, and biological effects would be necessary to fully understand its potential applications and safety profile.

Formula:C₁₈H₂₇NO₉

InChI:InChI=1S/C18H27NO9/c1-2-6-23-8-10-25-12-14-27-15-13-26-11-9-24-7-5-18(22)28-19-16(20)3-4-17(19)21/h1H,3-15H2

InChI key:InChIKey=ACZDUKRWTPZVRP-UHFFFAOYSA-N

SMILES:O=C(ON1C(=O)CCC1=O)CCOCCOCCOCCOCCOCC#C

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Propargyl-PEG5-NHS ester REF: IN-DA00HVJFCAS: 1393330-40-9	95%	122.00 €~611.00 €	Fri 28 Mar 25
Propargyl-PEG5-NHS ester REF: TM-T16621CAS: 1393330-40-9	98%	To inquire	Mon 31 Mar 25
Propargyl-PEG5-NHS Ester REF: 3B-P2283CAS: 1393330-40-9	- - -	102.00 €	Mon 31 Mar 25
Propargyl-PEG5-NHS Ester REF: 3D-TFC33040CAS: 1393330-40-9	Min. 95%	- - -	Discontinued product