
CAS 1393330-46-5
:Piperidine, 3-[5-(1,1-dimethylethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[5-(1,1-dimethylethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a substituent at the 3-position of the piperidine ring, specifically a 1,2,4-oxadiazole moiety that is further substituted with a tert-butyl group at the 5-position. This structure contributes to its potential biological activity and makes it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various properties such as being a potential ligand or inhibitor in biological systems, though specific activity would depend on further studies. Its CAS number, 1393330-46-5, allows for precise identification in chemical databases and literature. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H19N3O·ClH
InChI:InChI=1S/C11H19N3O.ClH/c1-11(2,3)10-13-9(14-15-10)8-5-4-6-12-7-8;/h8,12H,4-7H2,1-3H3;1H
InChI key:InChIKey=AXVIDDXWKHJPDN-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=NC(=NO1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-[5-(1,1-dimethylethyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(5-tert-Butyl-1,2,4-oxadiazol-3-yl)piperidine hydrochloride
CAS:Formula:C11H20ClN3OMolecular weight:245.75
