CAS 1393330-47-6
:2-(Cyclobutyloxy)-3-pyridinecarboxylic acid
Description:
2-(Cyclobutyloxy)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyridine ring and a cyclobutyl ether group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, potentially acting as a weak acid. The cyclobutyloxy moiety may influence the compound's steric and electronic properties, affecting its interactions with biological targets or other chemical species. Additionally, the pyridine ring can engage in hydrogen bonding and π-π stacking interactions, which may enhance its biological activity or influence its behavior in various solvents. Overall, the combination of these functional groups makes 2-(Cyclobutyloxy)-3-pyridinecarboxylic acid a compound of interest in medicinal chemistry and materials science, where its unique characteristics can be leveraged for specific applications.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c12-10(13)8-5-2-6-11-9(8)14-7-3-1-4-7/h2,5-7H,1,3-4H2,(H,12,13)
InChI key:InChIKey=BRLZEMLRHBMPSC-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C=CC=N1)C2CCC2
Synonyms:- 2-(Cyclobutyloxy)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-(cyclobutyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
