CAS 1393330-50-1
:Methyl tetrahydro-4-(2-pyridinyl)-2H-pyran-4-carboxylate
Description:
Methyl tetrahydro-4-(2-pyridinyl)-2H-pyran-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyran ring fused with a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylate functionalities. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methyl ester group suggests it may be relatively polar, influencing its solubility in various organic solvents. The pyridine ring can contribute to basicity and potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns typical of esters and heterocycles, such as nucleophilic substitution or cyclization reactions. Its applications could range from pharmaceuticals to agrochemicals, depending on the biological activity associated with its structure. As with any chemical, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c1-15-11(14)12(5-8-16-9-6-12)10-4-2-3-7-13-10/h2-4,7H,5-6,8-9H2,1H3
InChI key:InChIKey=BCHHVDVUMOEFNT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CCOCC1)C2=CC=CC=N2
Synonyms:- Methyl tetrahydro-4-(2-pyridinyl)-2H-pyran-4-carboxylate
- 2H-Pyran-4-carboxylic acid, tetrahydro-4-(2-pyridinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
