CymitQuimica logo

CAS 1393330-51-2

:

Tetrahydro-4-[[4-(trifluoromethyl)phenyl]methyl]-2H-pyran-4-carbonitrile

Description:
Tetrahydro-4-[[4-(trifluoromethyl)phenyl]methyl]-2H-pyran-4-carbonitrile is a chemical compound characterized by its unique molecular structure, which includes a pyran ring and a trifluoromethyl-substituted phenyl group. The presence of the carbonitrile functional group indicates that it contains a cyano group, which can influence its reactivity and polarity. This compound is likely to exhibit moderate to high lipophilicity due to the trifluoromethyl group, which can enhance its biological activity and interaction with various biological targets. The tetrahydro configuration suggests that it is a saturated compound, which may contribute to its stability. Additionally, the presence of multiple functional groups may allow for diverse chemical reactivity, making it of interest in pharmaceutical and material science applications. Its specific properties, such as solubility, melting point, and boiling point, would depend on the overall molecular interactions and the environment in which it is studied. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C14H14F3NO
InChI:InChI=1S/C14H14F3NO/c15-14(16,17)12-3-1-11(2-4-12)9-13(10-18)5-7-19-8-6-13/h1-4H,5-9H2
InChI key:InChIKey=VSETUUIIPVCOJE-UHFFFAOYSA-N
SMILES:C(C1(C#N)CCOCC1)C2=CC=C(C(F)(F)F)C=C2
Synonyms:
  • Tetrahydro-4-[[4-(trifluoromethyl)phenyl]methyl]-2H-pyran-4-carbonitrile
  • 2H-Pyran-4-carbonitrile, tetrahydro-4-[[4-(trifluoromethyl)phenyl]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.