CAS 1393330-53-4

5-(3-Oxetanyloxy)-2-pyridinecarboxylic acid

Description:

5-(3-Oxetanyloxy)-2-pyridinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyridine ring and an oxetane moiety. The presence of the carboxylic acid functional group contributes to its acidic properties, making it potentially useful in various chemical reactions and applications. The oxetane ring, a four-membered cyclic ether, introduces strain and can influence the compound's reactivity and stability. This compound may exhibit interesting biological activities due to its heterocyclic nature, which is often associated with pharmacological properties. Additionally, the presence of the pyridine ring can enhance solubility in polar solvents and facilitate interactions with biological targets. Its specific applications could range from medicinal chemistry to materials science, depending on its reactivity and functionalization potential. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of reactive functional groups. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₉H₉NO₄

InChI: InChI=1S/C9H9NO4/c11-9(12)8-2-1-6(3-10-8)14-7-4-13-5-7/h1-3,7H,4-5H2,(H,11,12)

InChI key: InChIKey=CNFWMQCBZFVFJW-UHFFFAOYSA-N

SMILES: O(C=1C=CC(C(O)=O)=NC1)C2COC2

Synonyms:

• 5-(3-Oxetanyloxy)-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 5-(3-oxetanyloxy)-

5-(Oxetan-3-yloxy)pyridine-2-carboxylic acid

CAS: 1393330-53-4

Formula: C₉H₉NO₄

Molecular weight: 195.174

Ref: 10-F214498