CAS 1393330-60-3

Tetrahydro-4-(2-pyridinylmethyl)-2H-pyran-4-carboxylic acid

Description:

Tetrahydro-4-(2-pyridinylmethyl)-2H-pyran-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a tetrahydropyran ring and a pyridine moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the pyridine ring suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific stereochemistry, which can influence its reactivity and biological activity. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the hydrophobic regions may affect its solubility in non-polar solvents. Additionally, the compound may participate in hydrogen bonding, which can impact its physical properties such as melting point and boiling point. Overall, Tetrahydro-4-(2-pyridinylmethyl)-2H-pyran-4-carboxylic acid represents a unique structure that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1S/C12H15NO3/c14-11(15)12(4-7-16-8-5-12)9-10-3-1-2-6-13-10/h1-3,6H,4-5,7-9H2,(H,14,15)

InChI key: InChIKey=HXAXDGJFFDWCEG-UHFFFAOYSA-N

SMILES: C(C1(C(O)=O)CCOCC1)C2=CC=CC=N2

Synonyms:

• 2H-Pyran-4-carboxylic acid, tetrahydro-4-(2-pyridinylmethyl)-
• Tetrahydro-4-(2-pyridinylmethyl)-2H-pyran-4-carboxylic acid
• 4-(Pyridin-2-ylmethyl)oxane-4-carboxylicacid