CymitQuimica logo

CAS 1393330-66-9

:

6-Bromo-3-(tetrahydro-2H-pyran-4-yl)-1,2,4-triazolo[4,3-a]pyridine

Description:
6-Bromo-3-(tetrahydro-2H-pyran-4-yl)-1,2,4-triazolo[4,3-a]pyridine is a chemical compound characterized by its unique structural features, which include a bromine atom and a tetrahydro-2H-pyran moiety attached to a triazolopyridine framework. This compound belongs to the class of heterocyclic compounds, which are known for their diverse biological activities. The presence of the triazole ring contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry. The tetrahydro-2H-pyran group may enhance solubility and bioavailability, while the bromine substituent can influence the compound's reactivity and interaction with biological targets. Additionally, compounds of this nature often exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological data would be required to confirm these effects for this particular substance. Overall, 6-Bromo-3-(tetrahydro-2H-pyran-4-yl)-1,2,4-triazolo[4,3-a]pyridine represents a promising candidate for further research in drug development and synthetic chemistry.
Formula:C11H12BrN3O
InChI:InChI=1S/C11H12BrN3O/c12-9-1-2-10-13-14-11(15(10)7-9)8-3-5-16-6-4-8/h1-2,7-8H,3-6H2
InChI key:InChIKey=WAYWTOVREFZLGG-UHFFFAOYSA-N
SMILES:BrC1=CN2C(=NN=C2C=C1)C3CCOCC3
Synonyms:
  • 1,2,4-Triazolo[4,3-a]pyridine, 6-bromo-3-(tetrahydro-2H-pyran-4-yl)-
  • 6-Bromo-3-(tetrahydro-2H-pyran-4-yl)-1,2,4-triazolo[4,3-a]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.