CAS 1393330-67-0
:2H-Pyran-4-amine, tetrahydro-4-(3-pyridinylmethyl)-, hydrochloride (1:2)
Description:
2H-Pyran-4-amine, tetrahydro-4-(3-pyridinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyran ring and a pyridine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form salts, as indicated by its hydrochloride form. The presence of the tetrahydropyran structure contributes to its potential for various interactions, including hydrogen bonding and hydrophobic interactions, which can influence its solubility and reactivity. The pyridine ring may impart additional pharmacological properties, making this compound of interest in medicinal chemistry. Its hydrochloride form suggests enhanced stability and solubility in aqueous environments, which is advantageous for biological applications. Overall, this compound's unique structural features and functional groups may lead to diverse applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C11H16N2O·2ClH
InChI:InChI=1S/C11H16N2O.2ClH/c12-11(3-6-14-7-4-11)8-10-2-1-5-13-9-10;;/h1-2,5,9H,3-4,6-8,12H2;2*1H
InChI key:InChIKey=OBLDMASNHMSDTK-UHFFFAOYSA-N
SMILES:C(C1(N)CCOCC1)C=2C=CC=NC2.Cl
Synonyms:- 2H-Pyran-4-amine, tetrahydro-4-(3-pyridinylmethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
