CAS 139339-45-0

Topotecan(Tpt)

Description:

Topotecan (Tpt) is a chemotherapeutic agent classified as a topoisomerase I inhibitor, primarily used in the treatment of various cancers, including ovarian cancer and small cell lung cancer. Its mechanism of action involves the stabilization of the topoisomerase I-DNA complex, leading to DNA damage and ultimately inducing apoptosis in cancer cells. Topotecan is typically administered intravenously or orally and is known for its ability to penetrate tissues effectively. The compound has a relatively short half-life, necessitating careful dosing and scheduling to maximize therapeutic effects while minimizing toxicity. Common side effects include myelosuppression, gastrointestinal disturbances, and fatigue. Due to its specific action on rapidly dividing cells, Topotecan is particularly effective against tumors with high proliferation rates. Its chemical structure features a lactone ring, which is crucial for its biological activity. Ongoing research continues to explore its efficacy in combination therapies and its potential in treating other malignancies.

Formula: C₈H₄FNO₂

InChI: InChI=1/C8H4FNO2/c9-7-2-1-5(4-10)3-6(7)8(11)12/h1-3H,(H,11,12)

Synonyms:

• Ro 24-7429
• 7-chloro-N-methyl-5-(1H-pyrrol-2-yl)-3H-1,4-benzodiazepin-2-amine
• 5-cyano-2-fluorobenzoic acid

Ro24-7429

CAS: 139339-45-0

Ro24-7429

Purity: ≥98%

Molecular weight: 272.73g/mol

Ref: 54-BUP07685

Ro24-7429

CAS: 139339-45-0

Ro24-7429: oral HIV-1 Tat antagonist, RUNX1 inhibitor with anti-HIV, antifibrotic, and anti-inflammatory properties.

Formula: C₁₄H₁₃ClN₄

Purity: 99.29% - 99.85%

Color and Shape: Solid

Molecular weight: 272.73

Ref: TM-T28578